CAS 139057-86-6 appears in our catalog under these names: 4-Fluoro-3-(trifluoromethyl)phenyl isocyanate, 98%, 4–Fluoro–3–(trifluoromethyl)phenyl isocyanate, 4-Fluoro-3-(trifluoromethyl)phenylisocyanate 97%, Benzene, 1-fluoro-4-isocyanato-2-(trifluoromethyl)-, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 10g, 1g, 500mg.
1-fluoro-4-isocyanato-2-(trifluoromethyl)benzene (CAS 139057-86-6) is a chemical compound with the molecular formula C8H3F4NO and a molecular weight of 205.11 g/mol. IUPAC name: 1-fluoro-4-isocyanato-2-(trifluoromethyl)benzene. InChIKey: OPPYFFRLKJUEOS-UHFFFAOYSA-N.
| Molecular formula | C8H3F4NO |
|---|---|
| Molecular weight | 205.11 g/mol |
| IUPAC name | 1-fluoro-4-isocyanato-2-(trifluoromethyl)benzene |
| InChIKey | OPPYFFRLKJUEOS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N=C=O)C(F)(F)F)F |
Computed by PubChem (NCBI)