Products 190774-54-0

CAS 190774-54-0 is the registry number for 4-Fluoro-2-(trifluoromethyl)phenyl isocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

4-fluoro-1-isocyanato-2-(trifluoromethyl)benzene (CAS 190774-54-0) is a chemical compound with the molecular formula C8H3F4NO and a molecular weight of 205.11 g/mol. IUPAC name: 4-fluoro-1-isocyanato-2-(trifluoromethyl)benzene. InChIKey: MNANIHSTOUUFNY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3F4NO
Molecular weight205.11 g/mol
IUPAC name4-fluoro-1-isocyanato-2-(trifluoromethyl)benzene
InChIKeyMNANIHSTOUUFNY-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)C(F)(F)F)N=C=O

Computed by PubChem (NCBI)