CAS 1323966-32-0 appears in our catalog under these names: 4-Fluoro-2-(trifluoromethoxy)benzonitrile, 95%, 4-Fluoro-2-(trifluoromethoxy)benzonitrile, 95+%, 4-Fluoro-2-(trifluoromethoxy)benzonitrile 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g, 250mg, 50mg, 100mg.
4-fluoro-2-(trifluoromethoxy)benzonitrile (CAS 1323966-32-0) is a chemical compound with the molecular formula C8H3F4NO and a molecular weight of 205.11 g/mol. IUPAC name: 4-fluoro-2-(trifluoromethoxy)benzonitrile. InChIKey: HGQQVVYULDWWOU-UHFFFAOYSA-N.
| Molecular formula | C8H3F4NO |
|---|---|
| Molecular weight | 205.11 g/mol |
| IUPAC name | 4-fluoro-2-(trifluoromethoxy)benzonitrile |
| InChIKey | HGQQVVYULDWWOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)OC(F)(F)F)C#N |
Computed by PubChem (NCBI)