CAS 190774-52-8 is the registry number for 2-Fluoro-3-(trifluoromethyl)phenyl isocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 10g, 1g.
2-fluoro-1-isocyanato-3-(trifluoromethyl)benzene (CAS 190774-52-8) is a chemical compound with the molecular formula C8H3F4NO and a molecular weight of 205.11 g/mol. IUPAC name: 2-fluoro-1-isocyanato-3-(trifluoromethyl)benzene. InChIKey: XBTHHWYOEISJNF-UHFFFAOYSA-N.
| Molecular formula | C8H3F4NO |
|---|---|
| Molecular weight | 205.11 g/mol |
| IUPAC name | 2-fluoro-1-isocyanato-3-(trifluoromethyl)benzene |
| InChIKey | XBTHHWYOEISJNF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N=C=O)F)C(F)(F)F |
Computed by PubChem (NCBI)