CAS 302912-19-2 appears in our catalog under these names: 3-Fluoro-5-(trifluoromethyl)phenyl isocyanate, 95%, 3-Fluoro-5-(trifluoromethyl)phenyl isocyanate, 97+% , 3-Fluoro-5-(trifluoromethyl)phenyl isocyanate 97%, 3-Fluoro-5-(trifluoromethyl)phenyl isocyanate, 97%, 97%. Offered by: Combi-blocks, Thermo Scientific, Ambeed, Chemat. Available pack sizes: 10g, 1g, 5g, 250mg, 25g.
1-fluoro-3-isocyanato-5-(trifluoromethyl)benzene (CAS 302912-19-2) is a chemical compound with the molecular formula C8H3F4NO and a molecular weight of 205.11 g/mol. IUPAC name: 1-fluoro-3-isocyanato-5-(trifluoromethyl)benzene. InChIKey: WGSXKYXKAARAKD-UHFFFAOYSA-N.
| Molecular formula | C8H3F4NO |
|---|---|
| Molecular weight | 205.11 g/mol |
| IUPAC name | 1-fluoro-3-isocyanato-5-(trifluoromethyl)benzene |
| InChIKey | WGSXKYXKAARAKD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1N=C=O)F)C(F)(F)F |
Computed by PubChem (NCBI)