CAS 886498-08-4 appears in our catalog under these names: 2-Fluoro-5-(trifluoromethoxy)benzonitrile, 97%, 2–Fluoro–5–(trifluoromethoxy)benzonitrile, 2-Fluoro-5-(trifluoromethoxy)benzonitrile 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g, 250mg, 10g.
2-fluoro-5-(trifluoromethoxy)benzonitrile (CAS 886498-08-4) is a chemical compound with the molecular formula C8H3F4NO and a molecular weight of 205.11 g/mol. IUPAC name: 2-fluoro-5-(trifluoromethoxy)benzonitrile. InChIKey: MFLGNKVMGUFLOV-UHFFFAOYSA-N.
| Molecular formula | C8H3F4NO |
|---|---|
| Molecular weight | 205.11 g/mol |
| IUPAC name | 2-fluoro-5-(trifluoromethoxy)benzonitrile |
| InChIKey | MFLGNKVMGUFLOV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)C#N)F |
Computed by PubChem (NCBI)