CAS 1260893-25-1 appears in our catalog under these names: tert-Butyl 2-(3-chloropyrazin-2-yl)-2-cyanoacetate, 95%, tert-Butyl 2-(3-chloropyrazin-2-yl)-2-cyanoacetate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 0,5g, 50mg.
Tert-butyl 2-(3-chloropyrazin-2-yl)-2-cyanoacetate (CAS 1260893-25-1) is a chemical compound with the molecular formula C11H12ClN3O2 and a molecular weight of 253.68 g/mol. IUPAC name: tert-butyl 2-(3-chloropyrazin-2-yl)-2-cyanoacetate. InChIKey: MBNOANHOMYFZOS-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3O2 |
|---|---|
| Molecular weight | 253.68 g/mol |
| IUPAC name | tert-butyl 2-(3-chloropyrazin-2-yl)-2-cyanoacetate |
| InChIKey | MBNOANHOMYFZOS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(C#N)C1=NC=CN=C1Cl |
Computed by PubChem (NCBI)