Products 500102-63-6
CAS 500102-63-6 is the registry number for ethyl (2E)-3-(4-chloro-2-fluorophenyl)prop-2-enoate, 97%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
Ethyl (E)-3-(4-chloro-2-fluorophenyl)prop-2-enoate (CAS 500102-63-6) is a chemical compound with the molecular formula C11H10ClFO2 and a molecular weight of 228.65 g/mol. IUPAC name: ethyl (E)-3-(4-chloro-2-fluorophenyl)prop-2-enoate. InChIKey: NCBILXCHPRXIRO-GQCTYLIASA-N.
| Molecular formula | C11H10ClFO2 |
|---|---|
| Molecular weight | 228.65 g/mol |
| IUPAC name | ethyl (E)-3-(4-chloro-2-fluorophenyl)prop-2-enoate |
| InChIKey | NCBILXCHPRXIRO-GQCTYLIASA-N |
| SMILES | CCOC(=O)/C=C/C1=C(C=C(C=C1)Cl)F |
Computed by PubChem (NCBI)