CAS 1261269-75-3 appears in our catalog under these names: Ethyl 4,6-dibromonicotinate, 98%, Ethyl 4,6-dibromonicotinate, 97%, 97%, Ethyl 4,6-dibromonicotinate, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
Ethyl 4,6-dibromopyridine-3-carboxylate (CAS 1261269-75-3) is a chemical compound with the molecular formula C8H7Br2NO2 and a molecular weight of 308.95 g/mol. IUPAC name: ethyl 4,6-dibromopyridine-3-carboxylate. InChIKey: JEJKXZZBGKWACN-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO2 |
|---|---|
| Molecular weight | 308.95 g/mol |
| IUPAC name | ethyl 4,6-dibromopyridine-3-carboxylate |
| InChIKey | JEJKXZZBGKWACN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(C=C1Br)Br |
Computed by PubChem (NCBI)