CAS 126147-70-4 appears in our catalog under these names: (S)-3-Methyl-2-((phenoxycarbonyl)amino)butanoic acid, 98%, N-Phenoxycarbonyl-L-valine, N-Phenoxycarbonyl-Val-OH 95%, (S)-3-Methyl-2-((phenoxycarbonyl)amino)butanoic acid, 98%, 98%, L-Valine, N-(phenoxycarbonyl)-, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 250mg, 100mg.
(2S)-3-methyl-2-(phenoxycarbonylamino)butanoic acid (CAS 126147-70-4) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: (2S)-3-methyl-2-(phenoxycarbonylamino)butanoic acid. InChIKey: HVJMEAOTIUMIBJ-JTQLQIEISA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (2S)-3-methyl-2-(phenoxycarbonylamino)butanoic acid |
| InChIKey | HVJMEAOTIUMIBJ-JTQLQIEISA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)OC1=CC=CC=C1 |
Computed by PubChem (NCBI)