Products 1261587-79-4
CAS 1261587-79-4 appears in our catalog under these names: 3,5-Difluoropyridine-2-sulfonyl chloride, 95%, 3,5-Difluoropyridine-2-sulfonyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
3,5-difluoropyridine-2-sulfonyl chloride (CAS 1261587-79-4) is a chemical compound with the molecular formula C5H2ClF2NO2S and a molecular weight of 213.59 g/mol. IUPAC name: 3,5-difluoropyridine-2-sulfonyl chloride. InChIKey: CIOHIQODKNEMPI-UHFFFAOYSA-N.
| Molecular formula | C5H2ClF2NO2S |
|---|---|
| Molecular weight | 213.59 g/mol |
| IUPAC name | 3,5-difluoropyridine-2-sulfonyl chloride |
| InChIKey | CIOHIQODKNEMPI-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1F)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)