Products 1261729-75-2

CAS 1261729-75-2 appears in our catalog under these names: 5,6-Difluoropyridine-3-sulfonyl chloride, 98%, 5,6-Difluoropyridine-3-sulfonyl chloride. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5,6-difluoropyridine-3-sulfonyl chloride (CAS 1261729-75-2) is a chemical compound with the molecular formula C5H2ClF2NO2S and a molecular weight of 213.59 g/mol. IUPAC name: 5,6-difluoropyridine-3-sulfonyl chloride. InChIKey: XLKGLGHYQVAISR-UHFFFAOYSA-N.

Identity
Molecular formulaC5H2ClF2NO2S
Molecular weight213.59 g/mol
IUPAC name5,6-difluoropyridine-3-sulfonyl chloride
InChIKeyXLKGLGHYQVAISR-UHFFFAOYSA-N
SMILESC1=C(C=NC(=C1F)F)S(=O)(=O)Cl

Computed by PubChem (NCBI)