CAS 1261729-75-2 appears in our catalog under these names: 5,6-Difluoropyridine-3-sulfonyl chloride, 98%, 5,6-Difluoropyridine-3-sulfonyl chloride. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5g, 50mg.
5,6-difluoropyridine-3-sulfonyl chloride (CAS 1261729-75-2) is a chemical compound with the molecular formula C5H2ClF2NO2S and a molecular weight of 213.59 g/mol. IUPAC name: 5,6-difluoropyridine-3-sulfonyl chloride. InChIKey: XLKGLGHYQVAISR-UHFFFAOYSA-N.
| Molecular formula | C5H2ClF2NO2S |
|---|---|
| Molecular weight | 213.59 g/mol |
| IUPAC name | 5,6-difluoropyridine-3-sulfonyl chloride |
| InChIKey | XLKGLGHYQVAISR-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)