Products 1803591-36-7
CAS 1803591-36-7 is the registry number for 5-Chloro-3-fluoropyridine-2-sulfonyl fluoride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-chloro-3-fluoropyridine-2-sulfonyl fluoride (CAS 1803591-36-7) is a chemical compound with the molecular formula C5H2ClF2NO2S and a molecular weight of 213.59 g/mol. IUPAC name: 5-chloro-3-fluoropyridine-2-sulfonyl fluoride. InChIKey: YNWZYTAOXBOFTA-UHFFFAOYSA-N.
| Molecular formula | C5H2ClF2NO2S |
|---|---|
| Molecular weight | 213.59 g/mol |
| IUPAC name | 5-chloro-3-fluoropyridine-2-sulfonyl fluoride |
| InChIKey | YNWZYTAOXBOFTA-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1F)S(=O)(=O)F)Cl |
Computed by PubChem (NCBI)