Products 1803731-66-9

CAS 1803731-66-9 appears in our catalog under these names: 2,4-Difluoropyridine-3-sulfonyl chloride, 98%, 2,4-Difluoropyridine-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2,4-difluoropyridine-3-sulfonyl chloride (CAS 1803731-66-9) is a chemical compound with the molecular formula C5H2ClF2NO2S and a molecular weight of 213.59 g/mol. IUPAC name: 2,4-difluoropyridine-3-sulfonyl chloride. InChIKey: ZGBXLBGZGTWLGH-UHFFFAOYSA-N.

Identity
Molecular formulaC5H2ClF2NO2S
Molecular weight213.59 g/mol
IUPAC name2,4-difluoropyridine-3-sulfonyl chloride
InChIKeyZGBXLBGZGTWLGH-UHFFFAOYSA-N
SMILESC1=CN=C(C(=C1F)S(=O)(=O)Cl)F

Computed by PubChem (NCBI)