Products 2757952-93-3
CAS 2757952-93-3 is the registry number for 2-(3-Chloroisothiazol-4-yl)-2,2-difluoroacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-chloro-1,2-thiazol-4-yl)-2,2-difluoroacetic acid (CAS 2757952-93-3) is a chemical compound with the molecular formula C5H2ClF2NO2S and a molecular weight of 213.59 g/mol. IUPAC name: 2-(3-chloro-1,2-thiazol-4-yl)-2,2-difluoroacetic acid. InChIKey: KHVMCDZIRUUUML-UHFFFAOYSA-N.
| Molecular formula | C5H2ClF2NO2S |
|---|---|
| Molecular weight | 213.59 g/mol |
| IUPAC name | 2-(3-chloro-1,2-thiazol-4-yl)-2,2-difluoroacetic acid |
| InChIKey | KHVMCDZIRUUUML-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NS1)Cl)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)