CAS 2138080-89-2 appears in our catalog under these names: 5-Chloro-6-fluoropyridine-3-sulfonyl fluoride, 98%, 5-Chloro-6-fluoropyridine-3-sulfonyl fluoride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-chloro-6-fluoropyridine-3-sulfonyl fluoride (CAS 2138080-89-2) is a chemical compound with the molecular formula C5H2ClF2NO2S and a molecular weight of 213.59 g/mol. IUPAC name: 5-chloro-6-fluoropyridine-3-sulfonyl fluoride. InChIKey: PARZZSYIHCEZCS-UHFFFAOYSA-N.
| Molecular formula | C5H2ClF2NO2S |
|---|---|
| Molecular weight | 213.59 g/mol |
| IUPAC name | 5-chloro-6-fluoropyridine-3-sulfonyl fluoride |
| InChIKey | PARZZSYIHCEZCS-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)F)S(=O)(=O)F |
Computed by PubChem (NCBI)