CAS 2639442-52-5 appears in our catalog under these names: 2-(2-Chlorothiazol-4-yl)-2,2-difluoroacetic acid, 98%, 2-(2-Chlorothiazol-4-yl)-2,2-difluoroacetic acid, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
2-(2-chloro-1,3-thiazol-4-yl)-2,2-difluoroacetic acid (CAS 2639442-52-5) is a chemical compound with the molecular formula C5H2ClF2NO2S and a molecular weight of 213.59 g/mol. IUPAC name: 2-(2-chloro-1,3-thiazol-4-yl)-2,2-difluoroacetic acid. InChIKey: YROQDOPKNBBFNZ-UHFFFAOYSA-N.
| Molecular formula | C5H2ClF2NO2S |
|---|---|
| Molecular weight | 213.59 g/mol |
| IUPAC name | 2-(2-chloro-1,3-thiazol-4-yl)-2,2-difluoroacetic acid |
| InChIKey | YROQDOPKNBBFNZ-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)Cl)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)