Products 1261603-16-0

CAS 1261603-16-0 is the registry number for 2-(2-Bromo-6-nitrophenyl)-2-hydroxyacetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(2-bromo-6-nitrophenyl)-2-hydroxyacetic acid (CAS 1261603-16-0) is a chemical compound with the molecular formula C8H6BrNO5 and a molecular weight of 276.04 g/mol. IUPAC name: 2-(2-bromo-6-nitrophenyl)-2-hydroxyacetic acid. InChIKey: MTTVGZUILBQITC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrNO5
Molecular weight276.04 g/mol
IUPAC name2-(2-bromo-6-nitrophenyl)-2-hydroxyacetic acid
InChIKeyMTTVGZUILBQITC-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Br)C(C(=O)O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)