CAS 1261603-16-0 is the registry number for 2-(2-Bromo-6-nitrophenyl)-2-hydroxyacetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-bromo-6-nitrophenyl)-2-hydroxyacetic acid (CAS 1261603-16-0) is a chemical compound with the molecular formula C8H6BrNO5 and a molecular weight of 276.04 g/mol. IUPAC name: 2-(2-bromo-6-nitrophenyl)-2-hydroxyacetic acid. InChIKey: MTTVGZUILBQITC-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO5 |
|---|---|
| Molecular weight | 276.04 g/mol |
| IUPAC name | 2-(2-bromo-6-nitrophenyl)-2-hydroxyacetic acid |
| InChIKey | MTTVGZUILBQITC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C(C(=O)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)