Products 127971-97-5
CAS 127971-97-5 appears in our catalog under these names: 6-Bromo-3-methoxy-2-nitrobenzoic acid, 97%, 97%, 6-Bromo-3-methoxy-2-nitrobenzoic acid, 95%, 6-Bromo-3-methoxy-2-nitrobenzoic acid 97%, 6-Bromo-3-methoxy-2-nitrobenzoic acid, 97%. Offered by: Chemat, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
6-bromo-3-methoxy-2-nitrobenzoic acid (CAS 127971-97-5) is a chemical compound with the molecular formula C8H6BrNO5 and a molecular weight of 276.04 g/mol. IUPAC name: 6-bromo-3-methoxy-2-nitrobenzoic acid. InChIKey: GDQNQIOGEJXLHT-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO5 |
|---|---|
| Molecular weight | 276.04 g/mol |
| IUPAC name | 6-bromo-3-methoxy-2-nitrobenzoic acid |
| InChIKey | GDQNQIOGEJXLHT-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Br)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)