Products 60541-89-1
CAS 60541-89-1 is the registry number for 5-bromo-2-methoxy-3-nitrobenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
5-bromo-2-methoxy-3-nitrobenzoic acid (CAS 60541-89-1) is a chemical compound with the molecular formula C8H6BrNO5 and a molecular weight of 276.04 g/mol. IUPAC name: 5-bromo-2-methoxy-3-nitrobenzoic acid. InChIKey: UYAFJWNETZAGDU-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO5 |
|---|---|
| Molecular weight | 276.04 g/mol |
| IUPAC name | 5-bromo-2-methoxy-3-nitrobenzoic acid |
| InChIKey | UYAFJWNETZAGDU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1[N+](=O)[O-])Br)C(=O)O |
Computed by PubChem (NCBI)