CAS 128627-49-6 is the registry number for 4-Bromo-2-nitrophenoxyacetic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(4-bromo-2-nitrophenoxy)acetic acid (CAS 128627-49-6) is a chemical compound with the molecular formula C8H6BrNO5 and a molecular weight of 276.04 g/mol. IUPAC name: 2-(4-bromo-2-nitrophenoxy)acetic acid. InChIKey: PNFGYDNFHHYLCK-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO5 |
|---|---|
| Molecular weight | 276.04 g/mol |
| IUPAC name | 2-(4-bromo-2-nitrophenoxy)acetic acid |
| InChIKey | PNFGYDNFHHYLCK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)[N+](=O)[O-])OCC(=O)O |
Computed by PubChem (NCBI)