CAS 25300-00-9 is the registry number for 2-Bromo-4-nitrophenoxyacetic acid, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 10g, 5g, 1g, on request.
2-(2-bromo-4-nitrophenoxy)acetic acid (CAS 25300-00-9) is a chemical compound with the molecular formula C8H6BrNO5 and a molecular weight of 276.04 g/mol. IUPAC name: 2-(2-bromo-4-nitrophenoxy)acetic acid. InChIKey: NPVFSPBETIYFKW-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO5 |
|---|---|
| Molecular weight | 276.04 g/mol |
| IUPAC name | 2-(2-bromo-4-nitrophenoxy)acetic acid |
| InChIKey | NPVFSPBETIYFKW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Br)OCC(=O)O |
Computed by PubChem (NCBI)