Products 83102-93-6

CAS 83102-93-6 is the registry number for 4-Bromo-5-hydroxy-2-nitro-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Methyl 4-bromo-5-hydroxy-2-nitrobenzoate (CAS 83102-93-6) is a chemical compound with the molecular formula C8H6BrNO5 and a molecular weight of 276.04 g/mol. IUPAC name: methyl 4-bromo-5-hydroxy-2-nitrobenzoate. InChIKey: JNXPPIOLXIBBLE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrNO5
Molecular weight276.04 g/mol
IUPAC namemethyl 4-bromo-5-hydroxy-2-nitrobenzoate
InChIKeyJNXPPIOLXIBBLE-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C=C1[N+](=O)[O-])Br)O

Computed by PubChem (NCBI)