Products 286377-18-2
CAS 286377-18-2 is the registry number for 5-Bromo-2-methoxy-4-nitrobenzoic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-bromo-2-methoxy-4-nitrobenzoic acid (CAS 286377-18-2) is a chemical compound with the molecular formula C8H6BrNO5 and a molecular weight of 276.04 g/mol. IUPAC name: 5-bromo-2-methoxy-4-nitrobenzoic acid. InChIKey: ACVATOGAHCMEKR-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO5 |
|---|---|
| Molecular weight | 276.04 g/mol |
| IUPAC name | 5-bromo-2-methoxy-4-nitrobenzoic acid |
| InChIKey | ACVATOGAHCMEKR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)O)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
5-Bromo-2-methoxy-4-nitrobenzoic acid