CAS 1261635-97-5 appears in our catalog under these names: 2-Methylbenzothiazole-7-carboxylic acid, 95%, 2–Methylbenzo(d)thiazole–7–carboxylic acid, 2-Methylbenzothiazole-7-Carboxylic Acid. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg, 0,5g, 50mg.
2-methyl-1,3-benzothiazole-7-carboxylic acid (CAS 1261635-97-5) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: 2-methyl-1,3-benzothiazole-7-carboxylic acid. InChIKey: MBPREMIBRBVZQQ-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 2-methyl-1,3-benzothiazole-7-carboxylic acid |
| InChIKey | MBPREMIBRBVZQQ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC=CC(=C2S1)C(=O)O |
Computed by PubChem (NCBI)