Products 1261642-82-3
CAS 1261642-82-3 is the registry number for 1-Chloro-3-(chloromethyl)-2-nitrobenzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-chloro-3-(chloromethyl)-2-nitrobenzene (CAS 1261642-82-3) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 1-chloro-3-(chloromethyl)-2-nitrobenzene. InChIKey: HSHFNZYZSHJQQH-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 1-chloro-3-(chloromethyl)-2-nitrobenzene |
| InChIKey | HSHFNZYZSHJQQH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)[N+](=O)[O-])CCl |
Computed by PubChem (NCBI)