Products 1261643-84-8

CAS 1261643-84-8 is the registry number for 2-(4-Chloro-2-methoxyphenyl)-2-hydroxyacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(4-chloro-2-methoxyphenyl)-2-hydroxyacetic acid (CAS 1261643-84-8) is a chemical compound with the molecular formula C9H9ClO4 and a molecular weight of 216.62 g/mol. IUPAC name: 2-(4-chloro-2-methoxyphenyl)-2-hydroxyacetic acid. InChIKey: RNLRRRDHRXSCEE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClO4
Molecular weight216.62 g/mol
IUPAC name2-(4-chloro-2-methoxyphenyl)-2-hydroxyacetic acid
InChIKeyRNLRRRDHRXSCEE-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)Cl)C(C(=O)O)O

Computed by PubChem (NCBI)