Products 1261653-43-3
CAS 1261653-43-3 appears in our catalog under these names: Methyl 3-bromo-2-cyanobenzoate, Methyl 3-bromo-2-cyanobenzoate, 95%, Methyl 3-bromo-2-cyanobenzoate, 97%. Offered by: Biosynth, Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 2,5g, 250mg, 100mg, 1g, 5g.
Methyl 3-bromo-2-cyanobenzoate (CAS 1261653-43-3) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: methyl 3-bromo-2-cyanobenzoate. InChIKey: JTKBWUQNFHIFIW-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | methyl 3-bromo-2-cyanobenzoate |
| InChIKey | JTKBWUQNFHIFIW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)Br)C#N |
Computed by PubChem (NCBI)