CAS 1261840-54-3 appears in our catalog under these names: Methyl 2-bromo-6-cyanobenzoate, 95%, Methyl 2-bromo-6-cyanobenzoate, 98%, Methyl 2-bromo-6-cyanobenzoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g, 50mg.
Methyl 2-bromo-6-cyanobenzoate (CAS 1261840-54-3) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: methyl 2-bromo-6-cyanobenzoate. InChIKey: KPDYUNUPSUHYJM-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | methyl 2-bromo-6-cyanobenzoate |
| InChIKey | KPDYUNUPSUHYJM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC=C1Br)C#N |
Computed by PubChem (NCBI)