Products 1261944-60-8
CAS 1261944-60-8 is the registry number for 5-(2,4-Dichlorophenyl)nicotinic acid, 97%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
5-(2,4-dichlorophenyl)pyridine-3-carboxylic acid (CAS 1261944-60-8) is a chemical compound with the molecular formula C12H7Cl2NO2 and a molecular weight of 268.09 g/mol. IUPAC name: 5-(2,4-dichlorophenyl)pyridine-3-carboxylic acid. InChIKey: LSLZNOAYFQHCQF-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2NO2 |
|---|---|
| Molecular weight | 268.09 g/mol |
| IUPAC name | 5-(2,4-dichlorophenyl)pyridine-3-carboxylic acid |
| InChIKey | LSLZNOAYFQHCQF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=CC(=CN=C2)C(=O)O |
Computed by PubChem (NCBI)