Products 1261954-99-7
CAS 1261954-99-7 is the registry number for 2-Hydroxy-5-(4-t-butylphenyl)isonicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-(4-tert-butylphenyl)-2-oxo-1H-pyridine-4-carboxylic acid (CAS 1261954-99-7) is a chemical compound with the molecular formula C16H17NO3 and a molecular weight of 271.31 g/mol. IUPAC name: 5-(4-tert-butylphenyl)-2-oxo-1H-pyridine-4-carboxylic acid. InChIKey: YQBLRHVZFWIFLH-UHFFFAOYSA-N.
| Molecular formula | C16H17NO3 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 5-(4-tert-butylphenyl)-2-oxo-1H-pyridine-4-carboxylic acid |
| InChIKey | YQBLRHVZFWIFLH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=CNC(=O)C=C2C(=O)O |
Computed by PubChem (NCBI)