CAS 1262132-92-2 appears in our catalog under these names: tert–Butyl 2,4–dichloronicotinate, tert-Butyl 2,4-dichloropyridine-3-carboxylate, tert-Butyl 2,4-dichloronicotinate 97%, Tert-butyl 2,4-dichloronicotinate, 97%, 97%, Tert-butyl 2,4-dichloronicotinate, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 0,5g.
Tert-butyl 2,4-dichloropyridine-3-carboxylate (CAS 1262132-92-2) is a chemical compound with the molecular formula C10H11Cl2NO2 and a molecular weight of 248.10 g/mol. IUPAC name: tert-butyl 2,4-dichloropyridine-3-carboxylate. InChIKey: DFYHULXZXQOJEP-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO2 |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | tert-butyl 2,4-dichloropyridine-3-carboxylate |
| InChIKey | DFYHULXZXQOJEP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=CN=C1Cl)Cl |
Computed by PubChem (NCBI)