CAS 1262142-69-7 is the registry number for 1,3-Bis(4-(allyloxy)phenyl)-3-hydroxyprop-2-en-1-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(Z)-3-hydroxy-1,3-bis(4-prop-2-enoxyphenyl)prop-2-en-1-one (CAS 1262142-69-7) is a chemical compound with the molecular formula C21H20O4 and a molecular weight of 336.4 g/mol. IUPAC name: (Z)-3-hydroxy-1,3-bis(4-prop-2-enoxyphenyl)prop-2-en-1-one. InChIKey: NISJCTPHEWGORP-HKWRFOASSA-N.
| Molecular formula | C21H20O4 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | (Z)-3-hydroxy-1,3-bis(4-prop-2-enoxyphenyl)prop-2-en-1-one |
| InChIKey | NISJCTPHEWGORP-HKWRFOASSA-N |
| SMILES | C=CCOC1=CC=C(C=C1)/C(=C/C(=O)C2=CC=C(C=C2)OCC=C)/O |
Computed by PubChem (NCBI)