Products 98873-76-8
CAS 98873-76-8 appears in our catalog under these names: Danshenxinkun D, Danshenxinkun D. Offered by: GLPBio, TargetMol, Biosynth. Available pack sizes: 5mg, 25mg, 50mg, 100mg, 10mg.
8-(hydroxymethyl)-4,8,9-trimethyl-9,10-dihydronaphtho[2,1-g]chromene-7,12-dione (CAS 98873-76-8) is a chemical compound with the molecular formula C21H20O4 and a molecular weight of 336.4 g/mol. IUPAC name: 8-(hydroxymethyl)-4,8,9-trimethyl-9,10-dihydronaphtho[2,1-g]chromene-7,12-dione. InChIKey: LOLTUKHHUOCHAV-UHFFFAOYSA-N.
| Molecular formula | C21H20O4 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 8-(hydroxymethyl)-4,8,9-trimethyl-9,10-dihydronaphtho[2,1-g]chromene-7,12-dione |
| InChIKey | LOLTUKHHUOCHAV-UHFFFAOYSA-N |
| SMILES | CC1COC2=C(C1(C)CO)C(=O)C3=C(C2=O)C4=CC=CC(=C4C=C3)C |
Computed by PubChem (NCBI)