Products 4491-03-6
CAS 4491-03-6 is the registry number for Bisphenol a diacrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
[4-[2-(4-prop-2-enoyloxyphenyl)propan-2-yl]phenyl] prop-2-enoate (CAS 4491-03-6) is a chemical compound with the molecular formula C21H20O4 and a molecular weight of 336.4 g/mol. IUPAC name: [4-[2-(4-prop-2-enoyloxyphenyl)propan-2-yl]phenyl] prop-2-enoate. InChIKey: FHLPGTXWCFQMIU-UHFFFAOYSA-N.
| Molecular formula | C21H20O4 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | [4-[2-(4-prop-2-enoyloxyphenyl)propan-2-yl]phenyl] prop-2-enoate |
| InChIKey | FHLPGTXWCFQMIU-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)OC(=O)C=C)C2=CC=C(C=C2)OC(=O)C=C |
Computed by PubChem (NCBI)
Synonyms:
2-Propenoic acid, (1-methylethylidene)di-4,1-phenylene ester, BISPHENOL A DIACRYLATE, Propane-2,2-diylbis(4,1-phenylene) diacrylate, [4-[2-(4-prop-2-enoyloxyphenyl)propan-2-yl]phenyl] Prop-2-enoate, FHLPGTXWCFQMIU-UHFFFAOYSA-N, [4-[1-methyl-1-(4-prop-2-enoyloxyphenyl)ethyl]phenyl] prop-2-enoate