Products 332026-26-3

CAS 332026-26-3 is the registry number for 5-{(4-(2-Phenylpropan-2-yl)phenoxy)methyl}furan-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

5-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]furan-2-carboxylic acid (CAS 332026-26-3) is a chemical compound with the molecular formula C21H20O4 and a molecular weight of 336.4 g/mol. IUPAC name: 5-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]furan-2-carboxylic acid. InChIKey: GVVLHKRUHHNBIB-UHFFFAOYSA-N.

Identity
Molecular formulaC21H20O4
Molecular weight336.4 g/mol
IUPAC name5-[[4-(2-phenylpropan-2-yl)phenoxy]methyl]furan-2-carboxylic acid
InChIKeyGVVLHKRUHHNBIB-UHFFFAOYSA-N
SMILESCC(C)(C1=CC=CC=C1)C2=CC=C(C=C2)OCC3=CC=C(O3)C(=O)O

Computed by PubChem (NCBI)