Products 910856-25-6
CAS 910856-25-6 is the registry number for Danshenol C. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
(1R,10R)-10-hydroxy-1,6-dimethyl-10-(2-oxopropyl)-1,2-dihydronaphtho[1,2-g][1]benzofuran-11-one (CAS 910856-25-6) is a chemical compound with the molecular formula C21H20O4 and a molecular weight of 336.4 g/mol. IUPAC name: (1R,10R)-10-hydroxy-1,6-dimethyl-10-(2-oxopropyl)-1,2-dihydronaphtho[1,2-g][1]benzofuran-11-one. InChIKey: WQYKPUPMMFGHQW-LAJNKCICSA-N.
| Molecular formula | C21H20O4 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | (1R,10R)-10-hydroxy-1,6-dimethyl-10-(2-oxopropyl)-1,2-dihydronaphtho[1,2-g][1]benzofuran-11-one |
| InChIKey | WQYKPUPMMFGHQW-LAJNKCICSA-N |
| SMILES | C[C@H]1COC2=C1C(=O)[C@](C3=C2C=CC4=C(C=CC=C43)C)(CC(=O)C)O |
Computed by PubChem (NCBI)
Synonyms:
Danshenol C, orb1682847