Products 189308-08-5
CAS 189308-08-5 appears in our catalog under these names: Danshenol A, Danshenol A, Danshenol A, 99.67%. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 5 mg, 1 mg.
(1R,10S)-10-hydroxy-1,6-dimethyl-10-(2-oxopropyl)-1,2-dihydronaphtho[1,2-g][1]benzofuran-11-one (CAS 189308-08-5) is a chemical compound with the molecular formula C21H20O4 and a molecular weight of 336.4 g/mol. IUPAC name: (1R,10S)-10-hydroxy-1,6-dimethyl-10-(2-oxopropyl)-1,2-dihydronaphtho[1,2-g][1]benzofuran-11-one. InChIKey: WQYKPUPMMFGHQW-QKVFXAPYSA-N.
| Molecular formula | C21H20O4 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | (1R,10S)-10-hydroxy-1,6-dimethyl-10-(2-oxopropyl)-1,2-dihydronaphtho[1,2-g][1]benzofuran-11-one |
| InChIKey | WQYKPUPMMFGHQW-QKVFXAPYSA-N |
| SMILES | C[C@H]1COC2=C1C(=O)[C@@](C3=C2C=CC4=C(C=CC=C43)C)(CC(=O)C)O |
Computed by PubChem (NCBI)
Synonyms:
Danshenol A, orb1682848