CAS 64620-10-6 is the registry number for 5-Methoxy-8,8-dimethyl-4-phenyl-9,10-dihydro-2h,8h-pyrano[2,3-f]chromen-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
5-methoxy-8,8-dimethyl-4-phenyl-9,10-dihydropyrano[2,3-h]chromen-2-one (CAS 64620-10-6) is a chemical compound with the molecular formula C21H20O4 and a molecular weight of 336.4 g/mol. IUPAC name: 5-methoxy-8,8-dimethyl-4-phenyl-9,10-dihydropyrano[2,3-h]chromen-2-one. InChIKey: BBWXUVRTELNMIS-UHFFFAOYSA-N.
| Molecular formula | C21H20O4 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 5-methoxy-8,8-dimethyl-4-phenyl-9,10-dihydropyrano[2,3-h]chromen-2-one |
| InChIKey | BBWXUVRTELNMIS-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C3C(=C(C=C2O1)OC)C(=CC(=O)O3)C4=CC=CC=C4)C |
Computed by PubChem (NCBI)