CAS 1266114-62-8 is the registry number for 4-Amino-5-nitronicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
4-amino-5-nitropyridine-3-carboxylic acid (CAS 1266114-62-8) is a chemical compound with the molecular formula C6H5N3O4 and a molecular weight of 183.12 g/mol. IUPAC name: 4-amino-5-nitropyridine-3-carboxylic acid. InChIKey: QSTHOKQQURERRT-UHFFFAOYSA-N.
| Molecular formula | C6H5N3O4 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 4-amino-5-nitropyridine-3-carboxylic acid |
| InChIKey | QSTHOKQQURERRT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)[N+](=O)[O-])N)C(=O)O |
Computed by PubChem (NCBI)