Products 1266114-62-8

CAS 1266114-62-8 is the registry number for 4-Amino-5-nitronicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

4-amino-5-nitropyridine-3-carboxylic acid (CAS 1266114-62-8) is a chemical compound with the molecular formula C6H5N3O4 and a molecular weight of 183.12 g/mol. IUPAC name: 4-amino-5-nitropyridine-3-carboxylic acid. InChIKey: QSTHOKQQURERRT-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5N3O4
Molecular weight183.12 g/mol
IUPAC name4-amino-5-nitropyridine-3-carboxylic acid
InChIKeyQSTHOKQQURERRT-UHFFFAOYSA-N
SMILESC1=C(C(=C(C=N1)[N+](=O)[O-])N)C(=O)O

Computed by PubChem (NCBI)