Products 77168-76-4
CAS 77168-76-4 is the registry number for 3–Carbamoyl–6–hydroxypyrazine–2–carboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
3-carbamoyl-6-oxo-1H-pyrazine-2-carboxylic acid (CAS 77168-76-4) is a chemical compound with the molecular formula C6H5N3O4 and a molecular weight of 183.12 g/mol. IUPAC name: 3-carbamoyl-6-oxo-1H-pyrazine-2-carboxylic acid. InChIKey: DAOFEKDZTJAXDB-UHFFFAOYSA-N.
| Molecular formula | C6H5N3O4 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 3-carbamoyl-6-oxo-1H-pyrazine-2-carboxylic acid |
| InChIKey | DAOFEKDZTJAXDB-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(NC1=O)C(=O)O)C(=O)N |
Computed by PubChem (NCBI)