Products 84487-09-2

CAS 84487-09-2 is the registry number for 2-Amino-5-nitroisonicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-amino-5-nitropyridine-4-carboxylic acid (CAS 84487-09-2) is a chemical compound with the molecular formula C6H5N3O4 and a molecular weight of 183.12 g/mol. IUPAC name: 2-amino-5-nitropyridine-4-carboxylic acid. InChIKey: DCHWNCQMEJONFH-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5N3O4
Molecular weight183.12 g/mol
IUPAC name2-amino-5-nitropyridine-4-carboxylic acid
InChIKeyDCHWNCQMEJONFH-UHFFFAOYSA-N
SMILESC1=C(C(=CN=C1N)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)