CAS 84487-09-2 is the registry number for 2-Amino-5-nitroisonicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-amino-5-nitropyridine-4-carboxylic acid (CAS 84487-09-2) is a chemical compound with the molecular formula C6H5N3O4 and a molecular weight of 183.12 g/mol. IUPAC name: 2-amino-5-nitropyridine-4-carboxylic acid. InChIKey: DCHWNCQMEJONFH-UHFFFAOYSA-N.
| Molecular formula | C6H5N3O4 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 2-amino-5-nitropyridine-4-carboxylic acid |
| InChIKey | DCHWNCQMEJONFH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1N)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)