Products 439681-56-8

CAS 439681-56-8 is the registry number for 6-(Nitroamino)-3-pyridinecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

6-nitramidopyridine-3-carboxylic acid (CAS 439681-56-8) is a chemical compound with the molecular formula C6H5N3O4 and a molecular weight of 183.12 g/mol. IUPAC name: 6-nitramidopyridine-3-carboxylic acid. InChIKey: OFWPHLJCNRCENK-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5N3O4
Molecular weight183.12 g/mol
IUPAC name6-nitramidopyridine-3-carboxylic acid
InChIKeyOFWPHLJCNRCENK-UHFFFAOYSA-N
SMILESC1=CC(=NC=C1C(=O)O)N[N+](=O)[O-]

Computed by PubChem (NCBI)