CAS 439681-56-8 is the registry number for 6-(Nitroamino)-3-pyridinecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
6-nitramidopyridine-3-carboxylic acid (CAS 439681-56-8) is a chemical compound with the molecular formula C6H5N3O4 and a molecular weight of 183.12 g/mol. IUPAC name: 6-nitramidopyridine-3-carboxylic acid. InChIKey: OFWPHLJCNRCENK-UHFFFAOYSA-N.
| Molecular formula | C6H5N3O4 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 6-nitramidopyridine-3-carboxylic acid |
| InChIKey | OFWPHLJCNRCENK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)O)N[N+](=O)[O-] |
Computed by PubChem (NCBI)