CAS 89488-06-2 appears in our catalog under these names: 6–Amino–5–nitronicotinic acid, 6-Amino-5-nitronicotinic acid 98%, 6-Amino-5-nitronicotinic acid, 95%, 95%, 6-Amino-5-nitronicotinic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg, 100g.
6-amino-5-nitropyridine-3-carboxylic acid (CAS 89488-06-2) is a chemical compound with the molecular formula C6H5N3O4 and a molecular weight of 183.12 g/mol. IUPAC name: 6-amino-5-nitropyridine-3-carboxylic acid. InChIKey: JDDGLUVPISQPKN-UHFFFAOYSA-N.
| Molecular formula | C6H5N3O4 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 6-amino-5-nitropyridine-3-carboxylic acid |
| InChIKey | JDDGLUVPISQPKN-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1[N+](=O)[O-])N)C(=O)O |
Computed by PubChem (NCBI)