CAS 6760-14-1 appears in our catalog under these names: 2-Amino-5-nitronicotinic acid, 98%, 2-Amino-5-nitronicotinic acid 98%, 2-Amino-5-nitronicotinic acid, 97%, 97%, 2-Amino-5-nitronicotinic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 100mg.
2-amino-5-nitropyridine-3-carboxylic acid (CAS 6760-14-1) is a chemical compound with the molecular formula C6H5N3O4 and a molecular weight of 183.12 g/mol. IUPAC name: 2-amino-5-nitropyridine-3-carboxylic acid. InChIKey: OVKURXPJUDVKKU-UHFFFAOYSA-N.
| Molecular formula | C6H5N3O4 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 2-amino-5-nitropyridine-3-carboxylic acid |
| InChIKey | OVKURXPJUDVKKU-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)