CAS 618-87-1 appears in our catalog under these names: 3,5-Dinitroaniline, 3,5-Dinitroaniline, >98.0%(GC), 3,5-Dinitroaniline, 98%, 3,5-DINITROANILINE, 97%, 3,5-Dinitroaniline, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Dr. Ehrenstorfer, Biosynth, TCI, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 100mg, 25g, 10g, 5g, 1g, 50g, 1x100mg, 1x1ml.
3,5-dinitroaniline (CAS 618-87-1) is a chemical compound with the molecular formula C6H5N3O4 and a molecular weight of 183.12 g/mol. IUPAC name: 3,5-dinitroaniline. InChIKey: MPBZUKLDHPOCLS-UHFFFAOYSA-N.
| Molecular formula | C6H5N3O4 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 3,5-dinitroaniline |
| InChIKey | MPBZUKLDHPOCLS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])N |
Computed by PubChem (NCBI)