CAS 1267952-21-5 is the registry number for (3,5-Dichloro-2-nitrophenyl)methanol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3,5-dichloro-2-nitrophenyl)methanol (CAS 1267952-21-5) is a chemical compound with the molecular formula C7H5Cl2NO3 and a molecular weight of 222.02 g/mol. IUPAC name: (3,5-dichloro-2-nitrophenyl)methanol. InChIKey: RXUULDPWXJWUKM-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO3 |
|---|---|
| Molecular weight | 222.02 g/mol |
| IUPAC name | (3,5-dichloro-2-nitrophenyl)methanol |
| InChIKey | RXUULDPWXJWUKM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CO)[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)