CAS 1269151-36-1 appears in our catalog under these names: 2,6-Bis(1H-pyrazol-1-yl)aniline, 2,6-Bis(1H-pyrazol-1-yl)aniline, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g.
2,6-di(pyrazol-1-yl)aniline (CAS 1269151-36-1) is a chemical compound with the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. IUPAC name: 2,6-di(pyrazol-1-yl)aniline. InChIKey: STTNPTLIOLZWED-UHFFFAOYSA-N.
| Molecular formula | C12H11N5 |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 2,6-di(pyrazol-1-yl)aniline |
| InChIKey | STTNPTLIOLZWED-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N2C=CC=N2)N)N3C=CC=N3 |
Computed by PubChem (NCBI)