CAS 126918-16-9 appears in our catalog under these names: (R)-1-(2,4-Difluorophenyl)-2-hydroxypropan-1-one, 98%, Efinaconazole Impurity 43, (R)-1-(2,4-Difluorophenyl)-2-hydroxy-1-propanone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
(2R)-1-(2,4-difluorophenyl)-2-hydroxypropan-1-one (CAS 126918-16-9) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: (2R)-1-(2,4-difluorophenyl)-2-hydroxypropan-1-one. InChIKey: REHMWFXPLWURSF-RXMQYKEDSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | (2R)-1-(2,4-difluorophenyl)-2-hydroxypropan-1-one |
| InChIKey | REHMWFXPLWURSF-RXMQYKEDSA-N |
| SMILES | C[C@H](C(=O)C1=C(C=C(C=C1)F)F)O |
Computed by PubChem (NCBI)