Products 1269773-18-3
CAS 1269773-18-3 appears in our catalog under these names: (R)-2-amino-2-(3,4-difluorophenyl)ethanol hydrochloride, 95%, 95%, (R)-2-AMINO-2-(3,4-DIFLUOROPHENYL)ETHAN-1-OL HCL, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-amino-2-(3,4-difluorophenyl)ethanol;hydrochloride (CAS 1269773-18-3) is a chemical compound with the molecular formula C8H10ClF2NO and a molecular weight of 209.62 g/mol. IUPAC name: (2R)-2-amino-2-(3,4-difluorophenyl)ethanol;hydrochloride. InChIKey: SCCIVQTWQZNGMX-QRPNPIFTSA-N.
| Molecular formula | C8H10ClF2NO |
|---|---|
| Molecular weight | 209.62 g/mol |
| IUPAC name | (2R)-2-amino-2-(3,4-difluorophenyl)ethanol;hydrochloride |
| InChIKey | SCCIVQTWQZNGMX-QRPNPIFTSA-N |
| SMILES | C1=CC(=C(C=C1[C@H](CO)N)F)F.Cl |
Computed by PubChem (NCBI)